Introduction：Basic information about CAS 6340-84-7|1-(4-chloroanilino)cyclopentanecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-chloroanilino)cyclopentanecarboxylic acid |
|---|
| CAS Number | 6340-84-7 | Molecular Weight | 239.69800 |
|---|
| Density | 1.359g/cm3 | Boiling Point | 436.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 217.8ºC |
|---|
Names
| Name | 1-(4-chloroanilino)cyclopentane-1-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.359g/cm3 |
|---|
| Boiling Point | 436.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14ClNO2 |
|---|
| Molecular Weight | 239.69800 |
|---|
| Flash Point | 217.8ºC |
|---|
| Exact Mass | 239.07100 |
|---|
| PSA | 49.33000 |
|---|
| LogP | 3.22230 |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | BJHGQMFLHAMKOJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1(Nc2ccc(Cl)cc2)CCCC1 |
|---|
