Introduction：Basic information about CAS 24623-24-3|6-Nitro-2,3-dihydro-1H-inden-1-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Nitro-2,3-dihydro-1H-inden-1-one |
|---|
| CAS Number | 24623-24-3 | Molecular Weight | 177.157 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 332.0±31.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.8±17.6 °C |
|---|
Names
| Name | 6-nitro-2,3-dihydroinden-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 332.0±31.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7NO3 |
|---|
| Molecular Weight | 177.157 |
|---|
| Flash Point | 169.8±17.6 °C |
|---|
| Exact Mass | 177.042587 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 1.92 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | MLRACZPAMDFORH-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CCc2ccc([N+](=O)[O-])cc21 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39-45-36/37 |
|---|
| HS Code | 2914700090 |
|---|
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 6-Nitro-2,3-dihydro-1H-inden-1-one |
| 2,3-Dihydro-6-nitro-1-oxo-1H-indene |
| 4-nitro-indan-1-one |
| 6-nitro-1-indatone |
| 6-nitroindan-l-one |
| 6-Nitro-2,3-dihydro-1H-inden-1-on |
| MFCD06656903 |
| 6-Nitro-1-indanone |
| 2,3-Dihydro-6-nitro-1H-inden-1-one |
| 1H-Inden-1-one, 2,3-dihydro-6-nitro- |
| EINECS 246-366-7 |
| 6-nitroindan-1-one |
| 2,3-diidro-6-nitro-1H-indene-1-one |
| 6-NITROINDANONE |
