Introduction:Basic information about CAS 175135-79-2|2-(4-methylphenoxy)pyridine-3-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-methylphenoxy)pyridine-3-carbonyl chloride |
|---|
| CAS Number | 175135-79-2 | Molecular Weight | 247.67700 |
|---|
| Density | 1.264g/cm3 | Boiling Point | 353.9ºC at 760mmHg |
|---|
| Molecular Formula | C13H10ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167.8ºC |
|---|
Names
| Name | 2-(4-methylphenoxy)pyridine-3-carbonyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.264g/cm3 |
|---|
| Boiling Point | 353.9ºC at 760mmHg |
|---|
| Molecular Formula | C13H10ClNO2 |
|---|
| Molecular Weight | 247.67700 |
|---|
| Flash Point | 167.8ºC |
|---|
| Exact Mass | 247.04000 |
|---|
| PSA | 39.19000 |
|---|
| LogP | 3.56130 |
|---|
| Vapour Pressure | 3.47E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | CGQBNLMZQVRGLL-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(Oc2ncccc2C(=O)Cl)cc1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|