Introduction:Basic information about CAS 3320-87-4|3-nitrophenyl isocyanate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-nitrophenyl isocyanate |
|---|
| CAS Number | 3320-87-4 | Molecular Weight | 164.11800 |
|---|
| Density | 1.32 g/cm3 | Boiling Point | 130-131 °C11 mm Hg(lit.) |
|---|
| Molecular Formula | C7H4N2O3 | Melting Point | 51-52 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | >230 °F |
|---|
| Symbol | GHS07, GHS08 | Signal Word | Danger |
|---|
Names
| Name | 1-isocyanato-3-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.32 g/cm3 |
|---|
| Boiling Point | 130-131 °C11 mm Hg(lit.) |
|---|
| Melting Point | 51-52 °C(lit.) |
|---|
| Molecular Formula | C7H4N2O3 |
|---|
| Molecular Weight | 164.11800 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 164.02200 |
|---|
| PSA | 75.25000 |
|---|
| LogP | 2.08530 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | GFFGYTMCNVMFAJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C=Nc1cccc([N+](=O)[O-])c1 |
|---|
| Storage condition | 0-6°C |
|---|
Safety Information
| Symbol | GHS07, GHS08 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H315-H319-H334-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338-P342 + P311 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R22 |
|---|
| Safety Phrases | S22-S26-S36/37-S45 |
|---|
| RIDADR | 2206 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2929109000 |
|---|
Customs
| HS Code | 2929109000 |
|---|
| Summary | 2929109000. other isocyanates. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-nitrobenzenisocyanate |
| EINECS 222-025-8 |
| 3-nitrophenylisocynate |
| 3-Nitrophenyl isocyanate |
| m-Nitrophenyl isocyanate |
| meta-nitrophenyl isocyanate |
| Isocyanic acid,m-nitrophenyl ester |
| MFCD00007220 |
| 3-nitro-phenyl isocyanate |
| Benzene,1-isocyanato-3-nitro |