Introduction:Basic information about CAS 4732-48-3|Pregna-1,4-diene-3,20-dione,9,11-dichloro-17,21-dihydroxy-16-methyl-, (11b,16a), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pregna-1,4-diene-3,20-dione,9,11-dichloro-17,21-dihydroxy-16-methyl-, (11b,16a)- |
|---|
| CAS Number | 4732-48-3 | Molecular Weight | 427.36100 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 588ºC at 760 mmHg |
|---|
| Molecular Formula | C22H28Cl2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 309.4ºC |
|---|
Names
| Name | (8S,9R,10S,11S,13S,14S,16R,17R)-9,11-dichloro-17-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 588ºC at 760 mmHg |
|---|
| Molecular Formula | C22H28Cl2O4 |
|---|
| Molecular Weight | 427.36100 |
|---|
| Flash Point | 309.4ºC |
|---|
| Exact Mass | 426.13600 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 3.41150 |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | OKWSMPYQIYKVDC-CXSFZGCWSA-N |
|---|
| SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(Cl)C(Cl)CC2(C)C1(O)C(=O)CO |
|---|
Synonyms
| Meclorisone |
| Meclorisona |
| Meclorisonum |