Introduction:Basic information about CAS 6486-29-9|Direct Yellow 24, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Direct Yellow 24 |
|---|
| CAS Number | 6486-29-9 | Molecular Weight | 296.32100 |
|---|
| Density | 1.265g/cm3 | Boiling Point | 586.4ºC at 760 mmHg |
|---|
| Molecular Formula | C17H16N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 308.4ºC |
|---|
Names
| Name | 4-{[(2E)-3-(4-Methoxyphenyl)-2-propenoyl]amino}benzamide |
|---|
Chemical & Physical Properties
| Density | 1.265g/cm3 |
|---|
| Boiling Point | 586.4ºC at 760 mmHg |
|---|
| Molecular Formula | C17H16N2O3 |
|---|
| Molecular Weight | 296.32100 |
|---|
| Flash Point | 308.4ºC |
|---|
| Exact Mass | 296.11600 |
|---|
| PSA | 81.42000 |
|---|
| LogP | 3.21930 |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | ADUAASDQTXSPNT-NYYWCZLTSA-N |
|---|
| SMILES | COc1ccc(C=CC(=O)Nc2ccc(C(N)=O)cc2)cc1 |
|---|