Introduction：Basic information about CAS 78756-33-9|Flumazenil Impurity F, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Flumazenil Impurity F |
|---|
| CAS Number | 78756-33-9 | Molecular Weight | 319.74300 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 554ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14ClN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 288.9ºC |
|---|
Names
| Name | Ethyl 8-chloro-5-methyl-6-oxo-5,6-dihydro-4H-imidazo[1,5-a][1,4]b enzodiazepine-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 554ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14ClN3O3 |
|---|
| Molecular Weight | 319.74300 |
|---|
| Flash Point | 288.9ºC |
|---|
| Exact Mass | 319.07200 |
|---|
| PSA | 64.43000 |
|---|
| LogP | 2.22590 |
|---|
| Index of Refraction | 1.658 |
|---|
| InChIKey | QORLMYYHZLDYOR-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ncn2c1CN(C)C(=O)c1cc(Cl)ccc1-2 |
|---|
Synonyms
| Ethyl 8-chloro-1-ethyl-4-oxo-4H-quinolizine-3-carboxylate |
| ethyl 8-chloro-1-ethyl-4H-quinolizin-4-one-3-carboxylate |
| Flumazenil Impurity F |
