Introduction:Basic information about CAS 82626-73-1|6-Chloro-2-(4-chlorophenyl)imidazo[1,2-α]pyridine-3-acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Chloro-2-(4-chlorophenyl)imidazo[1,2-α]pyridine-3-acetamide |
|---|
| CAS Number | 82626-73-1 | Molecular Weight | 320.17300 |
|---|
| Density | 1.47g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C15H11Cl2N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-[6-chloro-2-(4-chlorophenyl)imidazo[1,2-a]pyridin-3-yl]acetamide |
|---|
Chemical & Physical Properties
| Density | 1.47g/cm3 |
|---|
| Molecular Formula | C15H11Cl2N3O |
|---|
| Molecular Weight | 320.17300 |
|---|
| Exact Mass | 319.02800 |
|---|
| PSA | 61.38000 |
|---|
| LogP | 4.48560 |
|---|
| Index of Refraction | 1.691 |
|---|
| InChIKey | ZOUWHRHJCHJSGJ-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)Cc1c(-c2ccc(Cl)cc2)nc2ccc(Cl)cn12 |
|---|