Introduction：Basic information about CAS 18931-61-8|1-(4-Bromophenyl)-4,4,4-trifluoro-1,3-butanedione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-Bromophenyl)-4,4,4-trifluoro-1,3-butanedione |
|---|
| CAS Number | 18931-61-8 | Molecular Weight | 295.053 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 311.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6BrF3O2 | Melting Point | 53-55ºC |
|---|
| MSDS | / | Flash Point | 142.3±27.9 °C |
|---|
Names
| Name | 1-(4-bromophenyl)-4,4,4-trifluorobutane-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 311.7±42.0 °C at 760 mmHg |
|---|
| Melting Point | 53-55ºC |
|---|
| Molecular Formula | C10H6BrF3O2 |
|---|
| Molecular Weight | 295.053 |
|---|
| Flash Point | 142.3±27.9 °C |
|---|
| Exact Mass | 293.950317 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 4.93 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.497 |
|---|
| InChIKey | ITVIRNOCIDFYRZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccc(Br)cc1 |
|---|
Safety Information
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1-(4-bromophenyl)-4,4,4-trifluorobutane-1,3-dione |
| 1-(4-Bromophenyl)-4,4,4-trifluoro-1,3-butanedione |
| 4-(p-bromophenyl)-1,1,1-trifluorobutane-2,4-dione |
| 4,4,4-Trifluoro-1-(4-bromophenyl)1,3-butanedione |
| 4,4,4-trifluoro-1-(4-bromophenyl)butane-1,3-dione |
| (4'-BrC6H4)COCH2COCF3 |
| 4-bromobenzoyltrifluoroacetone |
| TOS-BB-0672 |
| 1,3-Butanedione, 1-(4-bromophenyl)-4,4,4-trifluoro- |
| 1-(4-bromo-phenyl)-4,4,4-trifluoro-butane-1,3-dione |
