Introduction：Basic information about CAS 649736-47-0|5-(Benzyloxy)-4-fluoro-2-methyl-1H-indole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(Benzyloxy)-4-fluoro-2-methyl-1H-indole |
|---|
| CAS Number | 649736-47-0 | Molecular Weight | 255.28700 |
|---|
| Density | 1.233g/cm3 | Boiling Point | 429.349ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14FNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 213.463ºC |
|---|
Names
| Name | 5-(Benzyloxy)-4-fluoro-2-methyl-1H-indole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.233g/cm3 |
|---|
| Boiling Point | 429.349ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14FNO |
|---|
| Molecular Weight | 255.28700 |
|---|
| Flash Point | 213.463ºC |
|---|
| Exact Mass | 255.10600 |
|---|
| PSA | 25.02000 |
|---|
| LogP | 4.19440 |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | YKJPLFDIYRGJGR-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc2c(F)c(OCc3ccccc3)ccc2[nH]1 |
|---|
Synonyms
| 6-Heptenoic acid,3-oxo-5-(phenylmethoxy)-,methyl ester |
| 5-benzyloxy-3-oxo-6-heptenoic acid methyl ester |
| 5-benzyloxy-4-fluoro-2-methyl-1H-indole |
