Introduction：Basic information about CAS 78541-97-6|Piquindone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Piquindone |
|---|
| CAS Number | 78541-97-6 | Molecular Weight | 246.34800 |
|---|
| Density | 1.103g/cm3 | Boiling Point | 419ºC at 760 mmHg |
|---|
| Molecular Formula | C15H22N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 207.2ºC |
|---|
Names
| Name | (4aS,8aS)-3-ethyl-2,6-dimethyl-4a,5,7,8,8a,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.103g/cm3 |
|---|
| Boiling Point | 419ºC at 760 mmHg |
|---|
| Molecular Formula | C15H22N2O |
|---|
| Molecular Weight | 246.34800 |
|---|
| Flash Point | 207.2ºC |
|---|
| Exact Mass | 246.17300 |
|---|
| PSA | 36.10000 |
|---|
| LogP | 2.13010 |
|---|
| Index of Refraction | 1.559 |
|---|
| InChIKey | PVZMYDPRVUCJKV-CMPLNLGQSA-N |
|---|
| SMILES | CCc1c(C)[nH]c2c1C(=O)C1CN(C)CCC1C2 |
|---|
Synonyms
| Piquindonum [Latin] |
| Piquindone |
| 4H-Pyrrolo(2,3-g)isoquinolin-4-one,3-ethyl-1,4a,5,6,7,8,8a,9-octahydro-2,6-dimethyl-,trans-(+-) |
| Piquindona [Spanish] |
| Ro 22-1319 |
| Piquindone [INN] |
| ( inverted exclamation markA)-trans-3-ethyl-1,4a,5,6,7,8,8a,9-octahydro-2,6-dimethyl-4h-pyrrolo[2,3-g]isoquinolin-4-one |
| Piquindona |
