Introduction:Basic information about CAS 101611-80-7|(3E)-2-(Diphenylacetyl)-3-[(2E)-2-propen-1-ylidenehydrazono]-1-in danone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3E)-2-(Diphenylacetyl)-3-[(2E)-2-propen-1-ylidenehydrazono]-1-in danone |
|---|
| CAS Number | 101611-80-7 | Molecular Weight | 392.44900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C26H20N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (3E)-2-(Diphenylacetyl)-3-[(2E)-2-propen-1-ylidenehydrazono]-1-in danone |
|---|
Chemical & Physical Properties
| Molecular Formula | C26H20N2O2 |
|---|
| Molecular Weight | 392.44900 |
|---|
| Exact Mass | 392.15200 |
|---|
| PSA | 58.86000 |
|---|
| LogP | 4.86120 |
|---|
| InChIKey | DZDKTKPIBKYPSR-ZBJQCLPLSA-N |
|---|
| SMILES | C=CC=NN=C1c2ccccc2C(=O)C1C(=O)C(c1ccccc1)c1ccccc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
|---|
| Risk Phrases | R25 |
|---|
| Safety Phrases | S36/37 |
|---|
| RIDADR | UN2811 6.1/PG 3 |
|---|