Introduction：Basic information about CAS 495415-51-5|4-Trifluoromethyl-piperidine-1,4-dicarboxylic acid mono-tert-butyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Trifluoromethyl-piperidine-1,4-dicarboxylic acid mono-tert-butyl ester |
|---|
| CAS Number | 495415-51-5 | Molecular Weight | 297.271 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 347.4±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H18F3NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 163.9±27.9 °C |
|---|
Names
| Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethyl)piperidine-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 347.4±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H18F3NO4 |
|---|
| Molecular Weight | 297.271 |
|---|
| Flash Point | 163.9±27.9 °C |
|---|
| Exact Mass | 297.118805 |
|---|
| PSA | 66.84000 |
|---|
| LogP | 2.29 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.457 |
|---|
| InChIKey | NECZIICXICWRHJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)O)(C(F)(F)F)CC1 |
|---|
Synonyms
| 4-trifluoromethyl-piperidine-1,4-dicarboxylic acid mono-tert-butyl ester |
| 1,4-Piperidinedicarboxylic acid, 4-(trifluoromethyl)-, 1-(1,1-dimethylethyl) ester |
| n-boc-4-trifluoromethylpiperidine-4-carboxylic acid |
| 1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-4-piperidinecarboxylic acid |
