Introduction：Basic information about CAS 63741-13-9|4,4'-Dianilino-1,1'-binaphthalene-5,5'-disulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Dianilino-1,1'-binaphthalene-5,5'-disulfonic acid |
|---|
| CAS Number | 63741-13-9 | Molecular Weight | 596.67300 |
|---|
| Density | 1.489g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C32H24N2O6S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4,4'-Dianilino-1,1'-binaphthalene-5,5'-disulfonic acid |
|---|
Chemical & Physical Properties
| Density | 1.489g/cm3 |
|---|
| Molecular Formula | C32H24N2O6S2 |
|---|
| Molecular Weight | 596.67300 |
|---|
| Exact Mass | 596.10800 |
|---|
| PSA | 149.56000 |
|---|
| LogP | 9.94820 |
|---|
| Index of Refraction | 1.754 |
|---|
| InChIKey | SBYQPEKNMQWJQO-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1cccc2c(-c3ccc(Nc4ccccc4)c4c(S(=O)(=O)O)cccc34)ccc(Nc3ccccc3)c12 |
|---|
