Introduction：Basic information about CAS 34817-42-0|5-BROMO-2.2.5-TRIMETHYL-1.3-DIOXANE-4.6-DIONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-BROMO-2.2.5-TRIMETHYL-1.3-DIOXANE-4.6-DIONE |
|---|
| CAS Number | 34817-42-0 | Molecular Weight | 237.04800 |
|---|
| Density | 1.552g/cm3 | Boiling Point | 364.6ºC at 760mmHg |
|---|
| Molecular Formula | C7H9BrO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.3ºC |
|---|
Names
| Name | 5-Bromo-2,2,5-trimethyl-1,3-dioxane-4,6-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.552g/cm3 |
|---|
| Boiling Point | 364.6ºC at 760mmHg |
|---|
| Molecular Formula | C7H9BrO4 |
|---|
| Molecular Weight | 237.04800 |
|---|
| Flash Point | 174.3ºC |
|---|
| Exact Mass | 235.96800 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 0.97610 |
|---|
| Index of Refraction | 1.483 |
|---|
| InChIKey | XCOQDRFRYIKEMS-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OC(=O)C(C)(Br)C(=O)O1 |
|---|
Synonyms
| 5-bromo-5-methyl-Meldrum's acid |
| 5-bromo-2,2,5-trimethyl-[1,3]dioxane-4,6-dione |
| 5-brom-2,2,5-trimethyl-1,3-dioxan-4,6-dione |
| methyl bromo Meldrum's acid |
| EINECS 252-227-1 |
| Cyclo-isopropyliden-2-bromo-2-methylmalonat |
