Introduction：Basic information about CAS 184150-81-0|Methyl 2-ethyl-1H-indole-6-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 2-ethyl-1H-indole-6-carboxylate |
|---|
| CAS Number | 184150-81-0 | Molecular Weight | 203.237 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 356.4±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H13NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.3±22.3 °C |
|---|
Names
| Name | Methyl 2-ethyl-1H-indole-6-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 356.4±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H13NO2 |
|---|
| Molecular Weight | 203.237 |
|---|
| Flash Point | 169.3±22.3 °C |
|---|
| Exact Mass | 203.094635 |
|---|
| PSA | 42.09000 |
|---|
| LogP | 3.11 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.610 |
|---|
| InChIKey | DETYGYFLEMGFIB-UHFFFAOYSA-N |
|---|
| SMILES | CCc1cc2ccc(C(=O)OC)cc2[nH]1 |
|---|
Synonyms
| methyl 2-ethylindole-6-carboxylate |
| Methyl 2-ethyl-1H-indole-6-carboxylate |
| 2-Ethyl-1H-indole-6-carboxylic acid methyl ester |
| 2-ethyl-6-methoxycarbonylindole |
| 1H-Indole-6-carboxylic acid, 2-ethyl-, methyl ester |
| 2-ethyl-6-methoxy-3-pyridineboronic acid |
| 2-ethyl-6-methoxypyridin-3-ylboronic acid |
| 2-Methoxy-6-ethyl-5-pyridinylboronic acid |
