Introduction：Basic information about CAS 4732-14-3|Benzene,2-ethoxy-1,3,5-trinitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene,2-ethoxy-1,3,5-trinitro- |
|---|
| CAS Number | 4732-14-3 | Molecular Weight | 257.15700 |
|---|
| Density | 1.554g/cm3 | Boiling Point | 411.4ºC at 760mmHg |
|---|
| Molecular Formula | C8H7N3O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 199.1ºC |
|---|
Names
| Name | 2-ethoxy-1,3,5-trinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.554g/cm3 |
|---|
| Boiling Point | 411.4ºC at 760mmHg |
|---|
| Molecular Formula | C8H7N3O7 |
|---|
| Molecular Weight | 257.15700 |
|---|
| Flash Point | 199.1ºC |
|---|
| Exact Mass | 257.02800 |
|---|
| PSA | 146.69000 |
|---|
| LogP | 2.11890 |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | AOZXETLGPZAZNK-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
|---|
Safety Information
| RIDADR | UN 0218 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 1.1 |
|---|
Synonyms
| ethyl 2,4,6-trinitrophenyl ether |
| 2,4,6-trinitro-phenetole |
| Pikrinsaeureaethyl-aether |
| 2,6-Trinitrophenetole |
| Aethyl-pikryl-aether |
| 2.4.6-Trinitro-1-aethoxy-benzol |
| 2,4,6-Trinitro-phenetol |
| Trinitrophenetole |
| Phenetole,4,6-trinitro |
| Picryl ethyl ether |
| Benzene,2-ethoxy-1,3,5-trinitro |
