Introduction:Basic information about CAS 65150-93-8|3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,18-tritriacontafluorooctadecyl acrylate |
|---|
| CAS Number | 65150-93-8 | Molecular Weight | 918.22600 |
|---|
| Density | 1.656 g/cm3 | Boiling Point | 349ºC at 760 mmHg |
|---|
| Molecular Formula | C21H7F33O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 159.4ºC |
|---|
Names
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,18-tritriacontafluorooctadecyl prop-2-enoate |
|---|
Chemical & Physical Properties
| Density | 1.656 g/cm3 |
|---|
| Boiling Point | 349ºC at 760 mmHg |
|---|
| Molecular Formula | C21H7F33O2 |
|---|
| Molecular Weight | 918.22600 |
|---|
| Flash Point | 159.4ºC |
|---|
| Exact Mass | 917.99200 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 11.19750 |
|---|
| Index of Refraction | 1.306 |
|---|
| InChIKey | UNWCENHMZWUSOR-UHFFFAOYSA-N |
|---|
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|