Introduction：Basic information about CAS 69466-83-7|5-(4-Methoxyphenyl)-3-(methylthio)-1,2,4-triazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(4-Methoxyphenyl)-3-(methylthio)-1,2,4-triazine |
|---|
| CAS Number | 69466-83-7 | Molecular Weight | 233.29000 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 440.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11N3OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220ºC |
|---|
Names
| Name | 5-(4-methoxyphenyl)-3-methylsulfanyl-1,2,4-triazine |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 440.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11N3OS |
|---|
| Molecular Weight | 233.29000 |
|---|
| Flash Point | 220ºC |
|---|
| Exact Mass | 233.06200 |
|---|
| PSA | 73.20000 |
|---|
| LogP | 2.26910 |
|---|
| Index of Refraction | 1.621 |
|---|
| InChIKey | ZLYZUYMSZPFXIK-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2cnnc(SC)n2)cc1 |
|---|
