Introduction：Basic information about CAS 69467-09-0|5,6-Bis(2-furyl)-3-methylthio-1,2,4-triazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6-Bis(2-furyl)-3-methylthio-1,2,4-triazine |
|---|
| CAS Number | 69467-09-0 | Molecular Weight | 259.28400 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 411.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H9N3O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 202.8ºC |
|---|
Names
| Name | 5,6-bis(furan-2-yl)-3-methylsulfanyl-1,2,4-triazine |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 411.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H9N3O2S |
|---|
| Molecular Weight | 259.28400 |
|---|
| Flash Point | 202.8ºC |
|---|
| Exact Mass | 259.04200 |
|---|
| PSA | 90.25000 |
|---|
| LogP | 3.11350 |
|---|
| Index of Refraction | 1.654 |
|---|
| InChIKey | SERAYZIPJKSYSO-UHFFFAOYSA-N |
|---|
| SMILES | CSc1nnc(-c2ccco2)c(-c2ccco2)n1 |
|---|
