Introduction：Basic information about CAS 78628-81-6|(Z)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (Z)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine |
|---|
| CAS Number | 78628-81-6 | Molecular Weight | 291.430 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 417.9±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H25N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 183.7±22.3 °C |
|---|
Names
| Name | (Z)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 417.9±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H25N |
|---|
| Molecular Weight | 291.430 |
|---|
| Flash Point | 183.7±22.3 °C |
|---|
| Exact Mass | 291.198700 |
|---|
| PSA | 3.24000 |
|---|
| LogP | 6.61 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | DOMXUEMWDBAQBQ-UITAMQMPSA-N |
|---|
| SMILES | CN(CC=CC#CC(C)(C)C)Cc1cccc2ccccc12 |
|---|
Synonyms
| (Z)-N-(6,6-dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalenemethanamine |
| Terbinafine hydrochloride specified impurity B [EP] |
| Terbinafine,(Z) |
| Terbinafine related compound B free base |
| AC1LU7MV |
| (Z)-N,6,6-trimethyl-N-(naphth-1-ylmethyl)hept-2-en-4-yn-1-amine |
| N-(6,6-dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthylmethyl amine |
| 1-Naphthalenemethanamine, N-[(2Z)-6,6-dimethyl-2-hepten-4-yn-1-yl]-N-methyl- |
| Terbinafine hydrochloride impurity,cis-terbinafine-[USP] |
| cis-Terbinafine |
| 1-Naphthalenemethanamine,N-((2Z)-6,6-dimethyl-2-hepten-4-ynyl)-N-methyl |
| (2Z)-N,6,6-Trimethyl-N-(1-naphthylmethyl)-2-hepten-4-yn-1-amine |
| UNII-S76S370M70 |
| (2Z)-N,6,6-Trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine |
