Introduction：Basic information about CAS 92151-76-3|9H-fluorene-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9H-fluorene-3-carboxylic acid |
|---|
| CAS Number | 92151-76-3 | Molecular Weight | 210.22800 |
|---|
| Density | / | Boiling Point | 408.9ºC at 760mmHg |
|---|
| Molecular Formula | C14H10O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 183.9ºC |
|---|
Names
| Name | 9H-fluorene-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 408.9ºC at 760mmHg |
|---|
| Molecular Formula | C14H10O2 |
|---|
| Molecular Weight | 210.22800 |
|---|
| Flash Point | 183.9ºC |
|---|
| Exact Mass | 210.06800 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 2.95600 |
|---|
| Index of Refraction | 1.679 |
|---|
| InChIKey | WYRSPZVTTMUNBL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc2c(c1)-c1ccccc1C2 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 9H-Fluorene-3-carboxylicacid |
| HMS1730B04 |
| fluoren-3-ylcarboxylic acid |
| Fluorene-3-carboxylic acid |
| Fluoren-3-carbonsaeure |
