Introduction:Basic information about CAS 3381-48-4|n-(4-methoxybenzylidene)-4-fluoroanilin&, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | n-(4-methoxybenzylidene)-4-fluoroanilin& |
|---|
| CAS Number | 3381-48-4 | Molecular Weight | 229.25000 |
|---|
| Density | 1.07g/cm3 | Boiling Point | 349.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12FNO | Melting Point | 65-69ºC(lit.) |
|---|
| MSDS | USA | Flash Point | 165.3ºC |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.07g/cm3 |
|---|
| Boiling Point | 349.7ºC at 760 mmHg |
|---|
| Melting Point | 65-69ºC(lit.) |
|---|
| Molecular Formula | C14H12FNO |
|---|
| Molecular Weight | 229.25000 |
|---|
| Flash Point | 165.3ºC |
|---|
| Exact Mass | 229.09000 |
|---|
| PSA | 21.59000 |
|---|
| LogP | 3.58490 |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | ZICFPEHQRZAFBZ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C=Nc2ccc(F)cc2)cc1 |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H318 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi,N |
|---|
| Risk Phrases | R41;R51/53 |
|---|
| Safety Phrases | S26;S39;S61 |
|---|
| RIDADR | UN 3077 9/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2925290090 |
|---|
Customs
| HS Code | 2925290090 |
|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4-methoxybenzylidene-N-4-fluorophenylanisidine |
| MFCD00028099 |
| p-methoxybenzylidene-p-fluoraniline |
| p-methoxybenzylidene-p-fluoro-aniline |