Introduction：Basic information about CAS 3388-01-0|bis[(tetrahydrofuran-2-yl)methyl] phthalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis[(tetrahydrofuran-2-yl)methyl] phthalate |
|---|
| CAS Number | 3388-01-0 | Molecular Weight | 334.36400 |
|---|
| Density | 1.208g/cm3 | Boiling Point | 445.9ºC at 760mmHg |
|---|
| Molecular Formula | C18H22O6 | Melting Point | ＜-15ºC |
|---|
| MSDS | / | Flash Point | 195.4ºC |
|---|
Names
| Name | bis(oxolan-2-ylmethyl) benzene-1,2-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.208g/cm3 |
|---|
| Boiling Point | 445.9ºC at 760mmHg |
|---|
| Melting Point | ＜-15ºC |
|---|
| Molecular Formula | C18H22O6 |
|---|
| Molecular Weight | 334.36400 |
|---|
| Flash Point | 195.4ºC |
|---|
| Exact Mass | 334.14200 |
|---|
| PSA | 71.06000 |
|---|
| LogP | 2.35820 |
|---|
| Index of Refraction | 1.533 |
|---|
| InChIKey | FVNABQUYTVWAOS-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OCC1CCCO1)c1ccccc1C(=O)OCC1CCCO1 |
|---|
Synonyms
| Phthalsaeure-bis-tetrahydrofurfurylester |
| EINECS 222-214-5 |
| Phthalsaeure-ditetrahydrofurfurylester |
| phthalic acid bis-tetrahydrofurfuryl ester |
