Introduction：Basic information about CAS 6448-82-4|2-Amino-5-ethoxybenzenesulphonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Amino-5-ethoxybenzenesulphonic acid |
|---|
| CAS Number | 6448-82-4 | Molecular Weight | 217.24200 |
|---|
| Density | 1.401g/cm3 | Boiling Point | 549.7ºC at 760 mmHg |
|---|
| Molecular Formula | C8H11NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 286.2ºC |
|---|
Names
| Name | 2-Amino-5-ethoxybenzenesulphonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.401g/cm3 |
|---|
| Boiling Point | 549.7ºC at 760 mmHg |
|---|
| Molecular Formula | C8H11NO4S |
|---|
| Molecular Weight | 217.24200 |
|---|
| Flash Point | 286.2ºC |
|---|
| Exact Mass | 217.04100 |
|---|
| PSA | 98.00000 |
|---|
| LogP | 2.57620 |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | KTFUNVBAGAPLLC-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccc(N)c(S(=O)(=O)O)c1 |
|---|
Safety Information
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 1-amino-4-ethoxybenzene-2-sulfonic acid |
| 5-Aethoxy-2-amino-benzolsulfonsaeure |
| 1-amino-4-ethoxybenzene-6-sulphonic acid |
| Einecs 229-243-2 |
| 4-Aminoethoxybenzene-3-sulfonic acid |
| 2-AMINO-5-ETHOXYBENZENESULFONIC ACID |
| 5-ethoxy-2-amino-benzenesulfonic acid |
| 4-aminophenetole-3-sulfonic acid |
| 4-phenetidine-3-sulfonic acid |
