Introduction:Basic information about CAS 89-21-4|p-Chloro-o-nitroanisole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-Chloro-o-nitroanisole |
|---|
| CAS Number | 89-21-4 | Molecular Weight | 187.580 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 279.6±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6ClNO3 | Melting Point | 97-99°C |
|---|
| MSDS | / | Flash Point | 122.9±21.8 °C |
|---|
Names
| Name | 4-Chloro-2-nitroanisole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 279.6±20.0 °C at 760 mmHg |
|---|
| Melting Point | 97-99°C |
|---|
| Molecular Formula | C7H6ClNO3 |
|---|
| Molecular Weight | 187.580 |
|---|
| Flash Point | 122.9±21.8 °C |
|---|
| Exact Mass | 187.003616 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 2.51 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.560 |
|---|
| InChIKey | OSAYFGJUEOYRHY-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Cl)cc1[N+](=O)[O-] |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-chloro-2-nitro-anisole |
| MFCD00024327 |
| 4-chloro-1-methoxy-2-nitro-benzene |
| 2-NITRO-4-CHLOROANISOLE |
| 4-Chlor-2-nitro-1-methoxy-benzol |
| 5-Chloro-2-methoxynitrobenzene |
| EINECS 201-887-9 |
| 4-Chloro-1-methoxy-2-nitrobenzene |
| 4-Chloro-2-nitrophenyl methyl ether |
| Methyl-(4-chlor-2-nitro-phenyl)-aether |
| 4-Chlor-2-nitro-anisol |
| 3-Chloro-6-methoxy-1-nitrobenzene |
| 1-Methoxy-2-nitro-4-chlorobenzene |
| Benzene, 4-chloro-1-methoxy-2-nitro- |
| Anisole, 4-chloro-2-nitro- |
| p-Chloro-o-nitroanisole |
| 2-nitryl-4-chloroanisole |