Introduction：Basic information about CAS 7745-93-9|2-Bromo-4-nitrotoluene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Bromo-4-nitrotoluene |
|---|
| CAS Number | 7745-93-9 | Molecular Weight | 216.032 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 280.4±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6BrNO2 | Melting Point | 76-77 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 123.4±21.8 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-Bromo-4-nitrotoluene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 280.4±20.0 °C at 760 mmHg |
|---|
| Melting Point | 76-77 °C(lit.) |
|---|
| Molecular Formula | C7H6BrNO2 |
|---|
| Molecular Weight | 216.032 |
|---|
| Flash Point | 123.4±21.8 °C |
|---|
| Exact Mass | 214.958176 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 2.98 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | XFZFJQHXWJIBQV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc([N+](=O)[O-])cc1Br |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S36/37/39-S26-S22 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | I; II; III |
|---|
Synonyms
| 2-Bromo-1-methyl-4-nitrobenzene |
| EINECS 231-809-9 |
| Benzene, 2-bromo-1-methyl-4-nitro- |
| 2-Br-1-me-4-nitrobenzene |
| 4-nitro-2-bromo toluene |
| 2-Methyl-5-nitrophenyl bromide |
| 2-bromo-4-nitro-toluene |
| Toluene,2-bromo-4-nitro |
| MFCD00007195 |
| 3-Bromo-4-methylnitrobenzene |
| Toluene, 2-bromo-4-nitro- |
| 1-Bromo-2-methyl-5-nitrobenzene |
| 2-Bromo-4-nitrotoluene |
| 3-Bromo-4-methyl-1-nitrobenzene |
