Introduction:Basic information about CAS 586-35-6|2-Bromoterephthalic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Bromoterephthalic acid |
|---|
| CAS Number | 586-35-6 | Molecular Weight | 245.027 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 421.6±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5BrO4 | Melting Point | 295-297 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 208.7±27.3 °C |
|---|
| Symbol | GHS06 | Signal Word | Danger |
|---|
Names
| Name | 2-Bromoterephthalic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 421.6±40.0 °C at 760 mmHg |
|---|
| Melting Point | 295-297 °C(lit.) |
|---|
| Molecular Formula | C8H5BrO4 |
|---|
| Molecular Weight | 245.027 |
|---|
| Flash Point | 208.7±27.3 °C |
|---|
| Exact Mass | 243.937119 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 2.30 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | QPBGNSFASPVGTP-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(C(=O)O)c(Br)c1 |
|---|
Safety Information
| Symbol | GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T:Toxic;Xi:Irritant; |
|---|
| Risk Phrases | R25;R36/37/38 |
|---|
| Safety Phrases | S26-S36-S45-S37/39 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 29173919 |
|---|
Customs
Synonyms
| 2-bromo-1,4-dicarboxylic acid |
| 2-Bromoterephthalic acid |
| 2-Bromoterephthalicacid |
| EINECS 209-572-8 |
| 2-Bromo-1,4-benzenedicarboxylic acid |
| 2-BroMoterephthalic acid 25GR |
| MFCD00002403 |
| BROMOTEREPHTHALIC ACID |
| 1,4-Benzenedicarboxylic acid, 2-bromo- |
| 2-fluoro-1,4-benzendicarboxylic acid |
| 2-bromobenzene-1,4-dicarboxylic acid |