Introduction：Basic information about CAS 18038-55-6|1,2-Ethynediylbis(trichlorosilane), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-Ethynediylbis(trichlorosilane) |
|---|
| CAS Number | 18038-55-6 | Molecular Weight | 292.910 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 174.7±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C2Cl6Si2 | Melting Point | 41752ºC |
|---|
| MSDS | / | Flash Point | 55.2±13.5 °C |
|---|
Names
| Name | trichloro(2-trichlorosilylethynyl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 174.7±9.0 °C at 760 mmHg |
|---|
| Melting Point | 41752ºC |
|---|
| Molecular Formula | C2Cl6Si2 |
|---|
| Molecular Weight | 292.910 |
|---|
| Flash Point | 55.2±13.5 °C |
|---|
| Exact Mass | 289.766968 |
|---|
| LogP | 10.08 |
|---|
| Appearance of Characters | liquid |
|---|
| Vapour Pressure | 1.6±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.517 |
|---|
| InChIKey | YVAMNMBARCMOTI-UHFFFAOYSA-N |
|---|
| SMILES | Cl[Si](Cl)(Cl)C#C[Si](Cl)(Cl)Cl |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Risk Phrases | 34-36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 1760 |
|---|
Synonyms
| 1,2-Ethynediylbis(trichlorosilane) |
| bis(trichlorosilyl)ethyne |
| Ethyne-1,2-diylbis(trichlorosilane) |
| 1,2-bis-(trichlorosilyl)acetylene |
| Silane, 1,1'-(1,2-ethynediyl)bis[1,1,1-trichloro- |
| Hexa-Si-chlor-Si,Si'-aethindiyl-bis-silan |
| Bis-trichlorsilyl-acetylen |
| Bis(trichlorsilyl)ethin |
| hexa-Si-chloro-Si,Si'-ethynediyl-bis-silane |
| Bis(trichlorosilyl)acetylene |
| B3215 |
