Introduction：Basic information about CAS 18023-33-1|Triisopropoxy(vinyl)silane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Triisopropoxy(vinyl)silane |
|---|
| CAS Number | 18023-33-1 | Molecular Weight | 232.392 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 221.7±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H24O3Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 86.6±26.2 °C |
|---|
Names
| Name | Tri(isopropoxy)vinylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 221.7±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H24O3Si |
|---|
| Molecular Weight | 232.392 |
|---|
| Flash Point | 86.6±26.2 °C |
|---|
| Exact Mass | 232.149475 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 5.76 |
|---|
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.423 |
|---|
| InChIKey | MABAWBWRUSBLKQ-UHFFFAOYSA-N |
|---|
| SMILES | C=C[Si](OC(C)C)(OC(C)C)OC(C)C |
|---|
Safety Information
| Hazard Codes | F+ |
|---|
| Risk Phrases | 10 |
|---|
| Safety Phrases | 23-24/25 |
|---|
| RIDADR | UN 1993 3/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| ethenyltris(1-methylethoxy)-silan |
| tris(isopropoxy)vinylsilane |
| Vinyltris(isopropoxy)silane |
| triisopropoxylvinylsilane |
| Vinyltriisoprooxysilane |
| Triisopropyloxyvinylsilane |
| Silane,triisopropoxyvinyl |
| triisopropoxyvinylsilane |
| Silane, ethenyltris(1-methylethoxy)- |
| Triisopropoxy(vinyl)silane |
| Vinyltri(isopropyloxy)silane |
| VINYLTRIISOPROPOXYSILANE |
| VINYLTRISOPROPOXYSILANE |
