Introduction:Basic information about CAS 18956-87-1|10H-Phenothiazine-10-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 10H-Phenothiazine-10-carbonyl chloride |
|---|
| CAS Number | 18956-87-1 | Molecular Weight | 261.727 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 416.1±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H8ClNOS | Melting Point | 168-172 °C |
|---|
| MSDS | / | Flash Point | 205.4±24.0 °C |
|---|
Names
| Name | Phenothiazine-10-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 416.1±28.0 °C at 760 mmHg |
|---|
| Melting Point | 168-172 °C |
|---|
| Molecular Formula | C13H8ClNOS |
|---|
| Molecular Weight | 261.727 |
|---|
| Flash Point | 205.4±24.0 °C |
|---|
| Exact Mass | 261.001526 |
|---|
| PSA | 45.61000 |
|---|
| LogP | 3.87 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.696 |
|---|
| InChIKey | MJRIZSDRKPPHTK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)N1c2ccccc2Sc2ccccc21 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S45-S36/37/39-S28A-S26-S24/25 |
|---|
| HS Code | 2934300000 |
|---|
Customs
| HS Code | 2934300000 |
|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 10-chlorocarbonyl-phenothiazine |
| 10H-Phenothiazine-10-carbonyl chloride |
| phenothioazine-10-carbonyl chloride |
| phenothiazine-10-carboxyl chloride |
| N-chloroformylphenothiazine |
| EINECS 242-699-7 |
| Phenothiazine-10-carbonyl chloride |
| N-chlorocarbonylphenothiazine |
| MFCD00044216 |
| BB_SC-5369 |