Introduction：Basic information about CAS 6452-61-5|di-n-butyldiphenyltin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | di-n-butyldiphenyltin |
|---|
| CAS Number | 6452-61-5 | Molecular Weight | 387.13700 |
|---|
| Density | 1.17 | Boiling Point | 270ºC(lit.) |
|---|
| Molecular Formula | C20H28Sn | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 110ºC |
|---|
| Symbol |
GHS06, GHS09 | Signal Word | Danger |
|---|
Names
| Name | di-n-butyldiphenyltin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17 |
|---|
| Boiling Point | 270ºC(lit.) |
|---|
| Molecular Formula | C20H28Sn |
|---|
| Molecular Weight | 387.13700 |
|---|
| Flash Point | 110ºC |
|---|
| Exact Mass | 388.12100 |
|---|
| LogP | 4.84980 |
|---|
| Index of Refraction | 1.562 |
|---|
| InChIKey | DTYWIPLKZHQUMW-UHFFFAOYSA-N |
|---|
| SMILES | CCCC[Sn](CCCC)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Symbol |
GHS06, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H311-H315-H319-H331-H335-H400 |
|---|
| Precautionary Statements | P261-P273-P280-P301 + P310-P305 + P351 + P338-P311 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
|---|
| Risk Phrases | R23/24/25;R36/37/38;R50/53 |
|---|
| Safety Phrases | 26-27-45-60-61 |
|---|
| RIDADR | UN 2788 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| dibutyl-diphenyl stannane |
| diphenyl-di-n-butyltin |
| dibutyldiphenyl-stannan |
| dibutyl diphenyl tin |
| DIBUTYLDIPHENYLTIN(IV) |
| Einecs 229-256-3 |
| di-n-butyldiphenylstannane |
| MFCD00031522 |
| TIN DIBUTYLDIPHENYL |
