Introduction：Basic information about CAS 923-09-1|Potassium hydrogen DL-aspartate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Potassium hydrogen DL-aspartate |
|---|
| CAS Number | 923-09-1 | Molecular Weight | 171.193 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C4H6KNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Potassium 3-amino-3-carboxypropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C4H6KNO4 |
|---|
| Molecular Weight | 171.193 |
|---|
| Exact Mass | 170.993393 |
|---|
| PSA | 112.68000 |
|---|
| InChIKey | TXXVQZSTAVIHFD-UHFFFAOYSA-M |
|---|
| SMILES | NC(CC(=O)[O-])C(=O)O.[K+] |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| HS Code | 2942000000 |
|---|
Customs
| HS Code | 2922509090 |
|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Aspartic acid, potassium salt |
| Potassium 2-amino-3-carboxypropanoate |
| potassium hydrogen aspartate |
| Butanedioate, 2-amino-, potassium salt, (2S)- (1:1) |
| Aspartic acid, potassium salt (1:1) |
| UNII:5UW00M8KR0 |
| Potassium hydrogen DL-aspartate |
