Introduction：Basic information about CAS 65874-27-3|2-Methyl-2-propanyl 4-formylbenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-2-propanyl 4-formylbenzoate |
|---|
| CAS Number | 65874-27-3 | Molecular Weight | 206.238 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 310.7±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 134.8±23.2 °C |
|---|
Names
| Name | tert-butyl 4-formylbenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 310.7±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H14O3 |
|---|
| Molecular Weight | 206.238 |
|---|
| Flash Point | 134.8±23.2 °C |
|---|
| Exact Mass | 206.094299 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 3.28 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | DUNFNBQQWYQKFE-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)c1ccc(C=O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Benzoic acid, 4-formyl-, 1,1-dimethylethyl ester |
| 4-formyl-benzoic acid tert-butyl ester |
| 2-Methyl-2-propanyl 4-formylbenzoate |
| tert-butyl 4-methanoylbenzoate |
| t-butyl p-formylbenzoate |
