Introduction：Basic information about CAS 4938-72-1|2,4,5-T-isobutyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4,5-T-isobutyl |
|---|
| CAS Number | 4938-72-1 | Molecular Weight | 311.58900 |
|---|
| Density | 1.322 g/cm3 | Boiling Point | 366.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H13Cl3O3 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 139.1ºC |
|---|
| Symbol |
GHS07, GHS09 | Signal Word | Warning |
|---|
Names
| Name | 2,4,5-T-isobutyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.322 g/cm3 |
|---|
| Boiling Point | 366.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H13Cl3O3 |
|---|
| Molecular Weight | 311.58900 |
|---|
| Flash Point | 139.1ºC |
|---|
| Exact Mass | 309.99300 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 4.22480 |
|---|
| Index of Refraction | 1.527 |
|---|
| InChIKey | KIIVFWSIMRWBKW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)COC(=O)COc1cc(Cl)c(Cl)cc1Cl |
|---|
| Stability | Stable. Hydrolyzes under acidic conditions. Keep cool. |
|---|
Safety Information
| Symbol |
GHS07, GHS09 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H315-H319-H335-H410 |
|---|
| Precautionary Statements | P261-P273-P305 + P351 + P338-P501 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn,N |
|---|
| Risk Phrases | 22-36/37/38-50/53 |
|---|
| Safety Phrases | 24-60-61 |
|---|
| RIDADR | UN3077 9/PG 3 |
|---|
Synonyms
| isobutyl (2,4,5-trichlorophenoxy)acetate |
| 2-methylpropyl (2,4,5-trichlorophenoxy)acetate |
| 2,4,5-T-2-methylpropyl ester |
| Isobutyl 2,4,5-T |
| 2,4,5-t Isobutyl ester |
| Caswell No. 881S |
| EINECS 225-580-4 |
| 2-Methylpropyl (2,4,5-trichlorophenoxy)acetate |
| 2-methylpropyl 2-(2,4,5-trichlorophenoxy)acetate |
