Introduction:Basic information about CAS 78613-35-1|Amorolfine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Amorolfine |
|---|
| CAS Number | 78613-35-1 | Molecular Weight | 317.509 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 407.1±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H35NO | Melting Point | 134ºC |
|---|
| MSDS | / | Flash Point | 119.6±27.7 °C |
|---|
Names
| Name | amorolfine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 407.1±33.0 °C at 760 mmHg |
|---|
| Melting Point | 134ºC |
|---|
| Molecular Formula | C21H35NO |
|---|
| Molecular Weight | 317.509 |
|---|
| Flash Point | 119.6±27.7 °C |
|---|
| Exact Mass | 317.271851 |
|---|
| PSA | 12.47000 |
|---|
| LogP | 5.73 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.489 |
|---|
| InChIKey | MQHLMHIZUIDKOO-AYHJJNSGSA-N |
|---|
| SMILES | CCC(C)(C)c1ccc(CC(C)CN2CC(C)OC(C)C2)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
Synonyms
| (±)-cis-2,6-Dimethyl-4-(2-methyl-3-(p-tert-pentylphenyl)propyl)morpholine |
| (±)-cis-2,6-Dimethyl-4-[2-methyl-3-(p-tert-pentylphenyl)propyl]morpholine |
| Ro-l4-4767/000 |
| 4-(3-(4-(1,1-Dimethylpropyl)phenyl)-2-methylpropyl)-2,6-dimethylmorpholine |
| Loceryl |
| amorolfin |
| cis-4-{3-[4-(1,1-dimethyl-propyl)-phenyl]-2-methyl-propyl}-2,6-dimethylmorpholine |
| (2R,6S)-2,6-Dimethyl-4-{2-methyl-3-[4-(2-methyl-2-butanyl)phenyl]propyl}morpholine |
| (2R,6S)-2,6-Dimethyl-4-{2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl}morpholine |
| Ro 14-4767/000 |
| Morpholine, 4-[3-[4-(1,1-dimethylpropyl)phenyl]-2-methylpropyl]-2,6-dimethyl-, (2R,6S)- |
| MFCD00865597 |
| cis-4-[3-[4-(1,1-Dimethylpropyl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine |
| (+/-)-cis-2,6-dimethyl-4-[2-methyl-3-(p-tert-pentylphenyl)propyl]morpholine |
| Amorolfine |
| Ro 14-4767 |
| SYLIMARIN |