Introduction:Basic information about CAS 1829-40-9|Hexaphenyldisiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hexaphenyldisiloxane |
|---|
| CAS Number | 1829-40-9 | Molecular Weight | 534.794 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 568.3±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C36H30OSi2 | Melting Point | ~225 °C |
|---|
| MSDS | / | Flash Point | 239.4±23.0 °C |
|---|
Names
| Name | triphenyl(triphenylsilyloxy)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 568.3±23.0 °C at 760 mmHg |
|---|
| Melting Point | ~225 °C |
|---|
| Molecular Formula | C36H30OSi2 |
|---|
| Molecular Weight | 534.794 |
|---|
| Flash Point | 239.4±23.0 °C |
|---|
| Exact Mass | 534.183533 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 13.47 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | IVZTVZJLMIHPEY-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc([Si](O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| hexaphenyldisiloxanne |
| EINECS 217-381-6 |
| Disiloxane, hexaphenyl- |
| triphenylsilyl ether |
| Hexaphenyldisiloxan |
| Benzene, 1,1',1'',1''',1'''',1'''''-(1,3-disiloxanediylidyne)hexakis- |
| 1,1,1,3,3,3-HEXAPHENYLDISILOXANE |
| Bis(triphenylsilyl)ether |
| MFCD00014068 |
| Hexaphenyldisiloxane |
| Disiloxane,hexaphenyl |