Introduction:Basic information about CAS 79694-56-7|[(8R,9S,10R,13S,14S,17R)-17-acetyl-6-(dibromomethylidene)-10,13-dimethyl-3-oxo, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-(dibromomethylidene)-10,13-dimethyl-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|
| CAS Number | 79694-56-7 | Molecular Weight | 556.32700 |
|---|
| Density | 1.5g/cm3 | Boiling Point | 547.7ºC at 760 mmHg |
|---|
| Molecular Formula | C25H32Br2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 285ºC |
|---|
Names
| Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-6-(dibromomethylidene)-10,13-dimethyl-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|
Chemical & Physical Properties
| Density | 1.5g/cm3 |
|---|
| Boiling Point | 547.7ºC at 760 mmHg |
|---|
| Molecular Formula | C25H32Br2O4 |
|---|
| Molecular Weight | 556.32700 |
|---|
| Flash Point | 285ºC |
|---|
| Exact Mass | 554.06700 |
|---|
| PSA | 60.44000 |
|---|
| LogP | 5.54610 |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | KGGCKWBZELPNDV-OFOWUMFPSA-N |
|---|
| SMILES | CC(=O)OC1(C(C)=O)CCC2C3CC(=C(Br)Br)C4=CC(=O)CCC4(C)C3CCC21C |
|---|