Introduction：Basic information about CAS 189816-05-5|4-Chloro-7-methoxy-2-phenylquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-7-methoxy-2-phenylquinoline |
|---|
| CAS Number | 189816-05-5 | Molecular Weight | 269.726 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 414.3±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H12ClNO | Melting Point | 96-99ºC |
|---|
| MSDS | / | Flash Point | 204.4±27.3 °C |
|---|
Names
| Name | 4-Chloro-7-methoxy-2-phenylquinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 414.3±40.0 °C at 760 mmHg |
|---|
| Melting Point | 96-99ºC |
|---|
| Molecular Formula | C16H12ClNO |
|---|
| Molecular Weight | 269.726 |
|---|
| Flash Point | 204.4±27.3 °C |
|---|
| Exact Mass | 269.060730 |
|---|
| PSA | 22.12000 |
|---|
| LogP | 4.82 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | BAZSITKSXXHTNS-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c(Cl)cc(-c3ccccc3)nc2c1 |
|---|
Synonyms
| 2-phenyl-4-chloro-7-methoxy-quinoline |
| 4-Chlor-7-methoxy-2-phenyl-chinolin |
| Quinoline, 4-chloro-7-methoxy-2-phenyl- |
| 4-Chloro-7-methoxy-2-phenylquinoline |
| 4-chloro-2-phenyl-7-methoxy quinoline |
