Introduction：Basic information about CAS 485-41-6|sulfachrysoidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sulfachrysoidine |
|---|
| CAS Number | 485-41-6 | Molecular Weight | 335.33800 |
|---|
| Density | 1.68g/cm3 | Boiling Point | 717.2ºC at 760mmHg |
|---|
| Molecular Formula | C13H13N5O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 387.6ºC |
|---|
Names
| Name | phenyl(phenylarsanylidene)arsane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.68g/cm3 |
|---|
| Boiling Point | 717.2ºC at 760mmHg |
|---|
| Molecular Formula | C13H13N5O4S |
|---|
| Molecular Weight | 335.33800 |
|---|
| Flash Point | 387.6ºC |
|---|
| Exact Mass | 335.06900 |
|---|
| PSA | 182.60000 |
|---|
| LogP | 4.55550 |
|---|
| Vapour Pressure | 1.37E-21mmHg at 25°C |
|---|
| Index of Refraction | 1.742 |
|---|
| InChIKey | ZELCNSAUMHNSSU-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(N)c(N=Nc2ccc(S(N)(=O)=O)cc2)c(C(=O)O)c1 |
|---|
Synonyms
| Sulfacarboxychrysoidin |
| sulfachrysoidine |
| (e)-diphenyldiarsene |
| 3,5-diamino-2-(4-sulfamoyl-phenylazo)-benzoic acid |
| 3,5-Diamino-2-(4-sulfamoyl-phenylazo)-benzoesaeure |
| 4.6-Diamino-4'-sulfamoyl-azobenzol-carbonsaeure-(2) |
