Introduction：Basic information about CAS 33124-50-4|fluocortin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fluocortin |
|---|
| CAS Number | 33124-50-4 | Molecular Weight | 390.44500 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 543.2ºC at 760mmHg |
|---|
| Molecular Formula | C22H27FO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 282.3ºC |
|---|
Names
| Name | 2-[(6S,8S,9S,10R,11S,13S,14S,16R,17S)-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 543.2ºC at 760mmHg |
|---|
| Molecular Formula | C22H27FO5 |
|---|
| Molecular Weight | 390.44500 |
|---|
| Flash Point | 282.3ºC |
|---|
| Exact Mass | 390.18400 |
|---|
| PSA | 91.67000 |
|---|
| LogP | 2.72900 |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | PUWHHWCHAVXSIG-NCLPIGKXSA-N |
|---|
| SMILES | CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3C(O)CC2(C)C1C(=O)C(=O)O |
|---|
Synonyms
| Fluocortolone-21-acid |
| Fluocortinum |
| Fluocortinum [INN-Latin] |
| Fluocortin (INN) |
| Fluocortine [INN-French] |
| Fluocortine |
