Introduction:Basic information about CAS 10355-14-3|1-[2-[4-[4-(trifluoromethyl)phenyl]phenoxy]ethyl]pyrrolidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[2-[4-[4-(trifluoromethyl)phenyl]phenoxy]ethyl]pyrrolidine |
|---|
| CAS Number | 10355-14-3 | Molecular Weight | 335.36300 |
|---|
| Density | 1.178g/cm3 | Boiling Point | 415.4ºC at 760mmHg |
|---|
| Molecular Formula | C19H20F3NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205ºC |
|---|
Names
| Name | 1-[2-[4-[4-(trifluoromethyl)phenyl]phenoxy]ethyl]pyrrolidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.178g/cm3 |
|---|
| Boiling Point | 415.4ºC at 760mmHg |
|---|
| Molecular Formula | C19H20F3NO |
|---|
| Molecular Weight | 335.36300 |
|---|
| Flash Point | 205ºC |
|---|
| Exact Mass | 335.15000 |
|---|
| PSA | 12.47000 |
|---|
| LogP | 4.78490 |
|---|
| Vapour Pressure | 4.14E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.524 |
|---|
| InChIKey | FOCUKKUAGZPPCU-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc(-c2ccc(OCCN3CCCC3)cc2)cc1 |
|---|
Synonyms
| Boxidina [INN-Spanish] |
| Boxidine |
| Boxidina |
| Boxidinum |
| Boxidine (USAN) |
| Boxidinum [INN-Latin] |
| Boxidine [USAN:INN] |