Introduction：Basic information about CAS 183266-61-7|(Trifluoroacetyl)benzotriazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (Trifluoroacetyl)benzotriazole |
|---|
| CAS Number | 183266-61-7 | Molecular Weight | 215.13200 |
|---|
| Density | 1.58g/cm3 | Boiling Point | 243.8ºC at 760 mmHg |
|---|
| Molecular Formula | C8H4F3N3O | Melting Point | 66-70ºC(lit.) |
|---|
| MSDS | / | Flash Point | 101.3ºC |
|---|
Names
| Name | 1-(benzotriazol-1-yl)-2,2,2-trifluoroethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.58g/cm3 |
|---|
| Boiling Point | 243.8ºC at 760 mmHg |
|---|
| Melting Point | 66-70ºC(lit.) |
|---|
| Molecular Formula | C8H4F3N3O |
|---|
| Molecular Weight | 215.13200 |
|---|
| Flash Point | 101.3ºC |
|---|
| Exact Mass | 215.03100 |
|---|
| PSA | 47.78000 |
|---|
| LogP | 1.63380 |
|---|
| Vapour Pressure | 0.0314mmHg at 25°C |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | GVQIQOIKWUOEJP-UHFFFAOYSA-N |
|---|
| SMILES | O=C(n1nnc2ccccc21)C(F)(F)F |
|---|
Safety Information
Synonyms
| 1-(trifluoroacetyl)-1H-benzotriazole |
| 1h-benzotriazole,1-(trifluoroacetyl) |
| 1-(trifluoroacetyl)benzotriazole |
| TFABI |
| MFCD00593044 |
| 1-(Trifluoromethyl)acetylbenzotriazole |
| trifluoroacetyl benzotriazole |
| N-Trifluoroacetylbenzotriazole |
