Introduction:Basic information about CAS 47369-00-6|1,1'-Diphenyl-4,4'-bipyridinium dichloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1'-Diphenyl-4,4'-bipyridinium dichloride |
|---|
| CAS Number | 47369-00-6 | Molecular Weight | 381.298 |
|---|
| Density | 1.043g/cm3 | Boiling Point | 451.1ºC at 760mmHg |
|---|
| Molecular Formula | C22H18Cl2N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 201.9ºC |
|---|
Names
| Name | 1-phenyl-4-(1-phenylpyridin-1-ium-4-yl)pyridin-1-ium,dichloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.043g/cm3 |
|---|
| Boiling Point | 451.1ºC at 760mmHg |
|---|
| Molecular Formula | C22H18Cl2N2 |
|---|
| Molecular Weight | 381.298 |
|---|
| Flash Point | 201.9ºC |
|---|
| Exact Mass | 380.084717 |
|---|
| PSA | 7.76000 |
|---|
| Index of Refraction | 1.561 |
|---|
| InChIKey | SZZVUWLOZBMPLX-UHFFFAOYSA-L |
|---|
| SMILES | [Cl-].[Cl-].c1ccc(-[n+]2ccc(-c3cc[n+](-c4ccccc4)cc3)cc2)cc1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
Synonyms
| D2165 |
| phenyl viologen dichloride |
| 4,4'-Bipyridinium, 1,1'-diphenyl-, dichloride |
| N,N'-diphenyl-4,4'-bipyridinium dichloride |
| 4,4'-Bipyridinium, 1,1'-diphenyl-, chloride (1:2) |
| 1,1'-Diphenyl-4,4'-bipyridinium dichloride |
| N,N'-diphenyl-4,4'-bipyridylium dichloride |