Introduction:Basic information about CAS 101089-83-2|4-p-tolylamino-benzoic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-p-tolylamino-benzoic acid methyl ester |
|---|
| CAS Number | 101089-83-2 | Molecular Weight | 241.28500 |
|---|
| Density | 1.15g/cm3 | Boiling Point | 389.4ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 189.3ºC |
|---|
Names
| Name | 4-p-tolylamino-benzoic acid methyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.15g/cm3 |
|---|
| Boiling Point | 389.4ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15NO2 |
|---|
| Molecular Weight | 241.28500 |
|---|
| Flash Point | 189.3ºC |
|---|
| Exact Mass | 241.11000 |
|---|
| PSA | 38.33000 |
|---|
| LogP | 3.59820 |
|---|
| Vapour Pressure | 2.85E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.605 |
|---|
| InChIKey | VXCBNZFZWOSTRQ-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(Nc2ccc(C)cc2)cc1 |
|---|
Synonyms
| methyl 4-(2-pyrrolidon-1-yl)benzoate |
| 1-(4-methoxycarbonylphenyl)pyrrolidin-2-one |
| N-(4-methoxycarbonylphenyl)-N-(4-methylphenyl)amine |
| 4'-Methyl-4-methoxycarbonyl-diphenylamin |
| 4-[(4-methylphenyl)amino]benzoic acid methyl ester |
| 4-(2-oxo-pyrrolidin-1-yl)-benzoic acid methyl ester |
| 4-p-Toluidino-benzoesaeure-methylester |
| methyl 4-(p-tolylamino)benzoate |
| N-(4-methoxycarbonylphenyl)-2-pyrrolidinone |
| 4-p-toluidino-benzoic acid methyl ester |