Introduction：Basic information about CAS 18651-15-5|4H-1-Benzopyran-4-one,7-hydroxy-3-methyl-2-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4H-1-Benzopyran-4-one,7-hydroxy-3-methyl-2-phenyl- |
|---|
| CAS Number | 18651-15-5 | Molecular Weight | 252.26500 |
|---|
| Density | 1.289g/cm3 | Boiling Point | 452.2ºC at 760mmHg |
|---|
| Molecular Formula | C16H12O3 | Melting Point | 278ºC |
|---|
| MSDS | / | Flash Point | 173.3ºC |
|---|
Names
| Name | 7-hydroxy-3-methyl-2-phenylchromen-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.289g/cm3 |
|---|
| Boiling Point | 452.2ºC at 760mmHg |
|---|
| Melting Point | 278ºC |
|---|
| Molecular Formula | C16H12O3 |
|---|
| Molecular Weight | 252.26500 |
|---|
| Flash Point | 173.3ºC |
|---|
| Exact Mass | 252.07900 |
|---|
| PSA | 50.44000 |
|---|
| LogP | 3.47400 |
|---|
| Vapour Pressure | 8.57E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | SUNCCQBNDWHMPR-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(-c2ccccc2)oc2cc(O)ccc2c1=O |
|---|
Safety Information
Customs
| HS Code | 2914400090 |
|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 7-Hydroxy-3-methyl-2-phenyl-chromen-4-on |
| 3-methyl-7-hydroxyflavone |
| 7-hydroxy-3-methyl-2-phenyl-chromen-4-one |
| 7-hydroxy-3-methyl-2-phenylchromone |
| 7-Hydroxy-3-methylflavone |
