Introduction：Basic information about CAS 5874-58-8|L-Proline, 1-benzoyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | L-Proline, 1-benzoyl- |
|---|
| CAS Number | 5874-58-8 | Molecular Weight | 219.23700 |
|---|
| Density | 1.296g/cm3 | Boiling Point | 428.9ºC at 760mmHg |
|---|
| Molecular Formula | C12H13NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 213.2ºC |
|---|
Names
| Name | (2S)-1-benzoylpyrrolidine-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.296g/cm3 |
|---|
| Boiling Point | 428.9ºC at 760mmHg |
|---|
| Molecular Formula | C12H13NO3 |
|---|
| Molecular Weight | 219.23700 |
|---|
| Flash Point | 213.2ºC |
|---|
| Exact Mass | 219.09000 |
|---|
| PSA | 57.61000 |
|---|
| LogP | 1.31370 |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | RQYKQWFHJOBBAO-JTQLQIEISA-N |
|---|
| SMILES | O=C(O)C1CCCN1C(=O)c1ccccc1 |
|---|
Synonyms
| N-Bz-proline |
| L-N-benzoylproline |
| N-benzoyl l-proline |
| L-Proline,1-benzoyl |
