Introduction：Basic information about CAS 630-51-3|Butanedioic acid,2,2,3,3-tetramethyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Butanedioic acid,2,2,3,3-tetramethyl- |
|---|
| CAS Number | 630-51-3 | Molecular Weight | 174.19400 |
|---|
| Density | 1.161g/cm3 | Boiling Point | 259.6ºC at 760 mmHg |
|---|
| Molecular Formula | C8H14O4 | Melting Point | 204-206ºC |
|---|
| MSDS | / | Flash Point | 125.1ºC |
|---|
Names
| Name | 2,2,3,3-tetramethylbutanedioic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.161g/cm3 |
|---|
| Boiling Point | 259.6ºC at 760 mmHg |
|---|
| Melting Point | 204-206ºC |
|---|
| Molecular Formula | C8H14O4 |
|---|
| Molecular Weight | 174.19400 |
|---|
| Flash Point | 125.1ºC |
|---|
| Exact Mass | 174.08900 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 1.20800 |
|---|
| Index of Refraction | 1.474 |
|---|
| InChIKey | CDPPYCZVWYZBJH-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C(=O)O)C(C)(C)C(=O)O |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| HS Code | 2917190090 |
|---|
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2,2,3,3-Tetramethylsuccinic acid |
| 2,2,3,3-TETRAFLUOROPROPYL TRIFLUOROACETATE |
| Succinic acid,tetramethyl |
| Butanedioic acid,tetramethyl |
| Tetramethyl-bernsteinsaeure |
| Tetramethylbutanedioic acid |
| tetramethyl succinic acid |
| 2,2,3,3-Tetramethylbutane-1,4-dioic acid |
