Introduction:Basic information about CAS 18362-49-7|1,3-bis(4-chlorophenyl)propane-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-bis(4-chlorophenyl)propane-1,3-dione |
|---|
| CAS Number | 18362-49-7 | Molecular Weight | 293.14500 |
|---|
| Density | 1.327g/cm3 | Boiling Point | 454ºC at 760 mmHg |
|---|
| Molecular Formula | C15H10Cl2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.2ºC |
|---|
Names
| Name | 1,3-bis(4-chlorophenyl)propane-1,3-dione |
|---|
Chemical & Physical Properties
| Density | 1.327g/cm3 |
|---|
| Boiling Point | 454ºC at 760 mmHg |
|---|
| Molecular Formula | C15H10Cl2O2 |
|---|
| Molecular Weight | 293.14500 |
|---|
| Flash Point | 191.2ºC |
|---|
| Exact Mass | 292.00600 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 4.44910 |
|---|
| Vapour Pressure | 1.97E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | DNXKZJFMYKDQNL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CC(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
|---|