Introduction:Basic information about CAS 63701-37-1|3-(Trifluoromethyl)phenylalanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(Trifluoromethyl)phenylalanine |
|---|
| CAS Number | 63701-37-1 | Molecular Weight | 233.187 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 301.2±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H10F3NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 135.9±27.9 °C |
|---|
Names
| Name | 3-(Trifluoromethyl)-DL-phenylalanine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 301.2±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H10F3NO2 |
|---|
| Molecular Weight | 233.187 |
|---|
| Flash Point | 135.9±27.9 °C |
|---|
| Exact Mass | 233.066360 |
|---|
| PSA | 63.32000 |
|---|
| LogP | 1.68 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.502 |
|---|
| InChIKey | BURBNIPKSRJAIQ-UHFFFAOYSA-N |
|---|
| SMILES | NC(Cc1cccc(C(F)(F)F)c1)C(=O)O |
|---|
Safety Information
| Hazard Codes | T,Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2922499990 |
|---|
Customs
| HS Code | 2922499990 |
|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| DL-m-Trifluoromethylphenylalanin |
| MFCD00069074 |
| 3-<3-Trifluormethyl-phenyl>-2-amino-propionsaeure |
| 3-(Trifluoromethyl)phenyl-DL-alanine |
| 3-trifluoromethylphenylalanine |
| 3-(Trifluoromethyl)phenylalanine |
| 2-Amino-3-[3-(trifluoromethyl)phenyl]propionic acid |
| QVYZ1R CXFFF &&DL Form |
| Phenylalanine, 3-(trifluoromethyl)- |
| 3-Trifluoromethyl-DL-phenylalanine |
| 2-Amino-3-[3-(trifluoromethyl)phenyl]propanoic acid |
| 3-(Trifluoromethyl)-DL-phenylalanine |
| 2812587 |